C22H24N4O3S2 — CID 3599557
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 3599557) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3599557 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C=CC(=O)Nc2nnc(Cc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H24N4O3S2/c1-3-26(4-2)31(28,29)19-13-10-17(11-14-19)12-15-20(27)23-22-25-24-21(30-22)16-18-8-6-5-7-9-18/h5-15H,3-4,16H2,1-2H3,(H,23,25,27) |
| InChIKey | GEKFTMZNRVUVMI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|