C40H46ClF3N2O5 — CID 3600319
1-[4-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone (PubChem CID 3600319) has the molecular formula C40H46ClF3N2O5 and a molecular weight of 727.26 g/mol. Its IUPAC name is 1-[4-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 3600319 |
| Molecular Formula | C40H46ClF3N2O5 |
| Molecular Weight | 727.26 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | 1-[4-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC2(O)CCC3c4ccc(cc4C(=O)c4ccc(-c5cc(C(F)(F)F)ccc5Cl)o4)CC(O)CCC(C)=CCCC32C)CC1 |
| InChI | InChI=1S/C40H46ClF3N2O5/c1-25-5-4-15-38(3)33(14-16-39(38,50)24-45-17-19-46(20-18-45)26(2)47)30-10-7-27(21-29(48)9-6-25)22-31(30)37(49)36-13-12-35(51-36)32-23-28(40(42,43)44)8-11-34(32)41/h5,7-8,10-13,22-23,29,33,48,50H,4,6,9,14-21,24H2,1-3H3 |
| InChIKey | YKGZSGIDWXHGAA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.26 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|