C23H24ClN3O3S — CID 3603018
N-[3-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-naphthalen-2-ylsulfonylacetamide (PubChem CID 3603018) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is N-[3-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-naphthalen-2-ylsulfonylacetamide.
| Compound Name | N-[3-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-naphthalen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 3603018 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[3-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-naphthalen-2-ylsulfonylacetamide |
| SMILES | CN1CCN(c2c(Cl)cccc2NC(=O)CS(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-26-11-13-27(14-12-26)23-20(24)7-4-8-21(23)25-22(28)16-31(29,30)19-10-9-17-5-2-3-6-18(17)15-19/h2-10,15H,11-14,16H2,1H3,(H,25,28) |
| InChIKey | NWHSTKVSDLSMJI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |