C29H21N3O11S — CID 3605856
3-(2,4-dinitro-5-phenylmethoxy-3-phenylmethoxycarbonylphenyl)sulfanyl-4-methyl-2-nitrobenzoic acid (PubChem CID 3605856) has the molecular formula C29H21N3O11S and a molecular weight of 619.56 g/mol. Its IUPAC name is 3-(2,4-dinitro-5-phenylmethoxy-3-phenylmethoxycarbonylphenyl)sulfanyl-4-methyl-2-nitrobenzoic acid.
| Compound Name | 3-(2,4-dinitro-5-phenylmethoxy-3-phenylmethoxycarbonylphenyl)sulfanyl-4-methyl-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 3605856 |
| Molecular Formula | C29H21N3O11S |
| Molecular Weight | 619.56 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | 3-(2,4-dinitro-5-phenylmethoxy-3-phenylmethoxycarbonylphenyl)sulfanyl-4-methyl-2-nitrobenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c([N+](=O)[O-])c1Sc1cc(OCc2ccccc2)c([N+](=O)[O-])c(C(=O)OCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C29H21N3O11S/c1-17-12-13-20(28(33)34)24(30(36)37)27(17)44-22-14-21(42-15-18-8-4-2-5-9-18)25(31(38)39)23(26(22)32(40)41)29(35)43-16-19-10-6-3-7-11-19/h2-14H,15-16H2,1H3,(H,33,34) |
| InChIKey | PYLMTPPBNRNGGP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 202.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|