C29H21N3O7 — CID 3608877
[4-[11-(3-nitrobenzoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]phenyl] acetate (PubChem CID 3608877) has the molecular formula C29H21N3O7 and a molecular weight of 523.50 g/mol. Its IUPAC name is [4-[11-(3-nitrobenzoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]phenyl] acetate.
| Compound Name | [4-[11-(3-nitrobenzoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]phenyl] acetate |
|---|---|
| PubChem CID | 3608877 |
| Molecular Formula | C29H21N3O7 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | [4-[11-(3-nitrobenzoyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C3C(C2=O)C2c4ccccc4C=CN2C3C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C29H21N3O7/c1-16(33)39-21-11-9-19(10-12-21)31-28(35)23-24(29(31)36)26(27(34)18-6-4-7-20(15-18)32(37)38)30-14-13-17-5-2-3-8-22(17)25(23)30/h2-15,23-26H,1H3 |
| InChIKey | VZSIHNPOKJBQQL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|