C29H21N3O7 — CID 124894669
[4-[(1S,11S,12R,16R)-14-(3-nitrophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate (PubChem CID 124894669) has the molecular formula C29H21N3O7 and a molecular weight of 523.50 g/mol. Its IUPAC name is [4-[(1S,11S,12R,16R)-14-(3-nitrophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate.
| Compound Name | [4-[(1S,11S,12R,16R)-14-(3-nitrophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 124894669 |
| Molecular Formula | C29H21N3O7 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | [4-[(1S,11S,12R,16R)-14-(3-nitrophenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)[C@H]3[C@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C29H21N3O7/c1-16(33)39-21-11-9-18(10-12-21)27(34)26-24-23(25-22-8-3-2-5-17(22)13-14-30(25)26)28(35)31(29(24)36)19-6-4-7-20(15-19)32(37)38/h2-15,23-26H,1H3/t23-,24-,25-,26+/m1/s1 |
| InChIKey | POLBNWSKKGGQQL-POTDNYQPSA-N |
| XLogP | 3.92 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|