C27H18N4O7 — CID 3728873
11-(3-nitrobenzoyl)-14-(3-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3728873) has the molecular formula C27H18N4O7 and a molecular weight of 510.46 g/mol. Its IUPAC name is 11-(3-nitrobenzoyl)-14-(3-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 11-(3-nitrobenzoyl)-14-(3-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3728873 |
| Molecular Formula | C27H18N4O7 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 11-(3-nitrobenzoyl)-14-(3-nitrophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)C1C2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H18N4O7/c32-25(16-6-3-8-18(13-16)30(35)36)24-22-21(23-20-10-2-1-5-15(20)11-12-28(23)24)26(33)29(27(22)34)17-7-4-9-19(14-17)31(37)38/h1-14,21-24H |
| InChIKey | VLVIUPPREMHOAA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|