C12H11BrN2O2 — CID 3611927
2-(2-bromophenyl)-4-(dimethylaminomethylidene)-1,3-oxazol-5-one (PubChem CID 3611927) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4-(dimethylaminomethylidene)-1,3-oxazol-5-one.
| Compound Name | 2-(2-bromophenyl)-4-(dimethylaminomethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3611927 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2-(2-bromophenyl)-4-(dimethylaminomethylidene)-1,3-oxazol-5-one |
| SMILES | CN(C)C=C1N=C(c2ccccc2Br)OC1=O |
| InChI | InChI=1S/C12H11BrN2O2/c1-15(2)7-10-12(16)17-11(14-10)8-5-3-4-6-9(8)13/h3-7H,1-2H3 |
| InChIKey | WDOLOFAMGMBDIA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|