C24H26BrNO3 — CID 19669182
(4Z)-2-(2-bromophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19669182) has the molecular formula C24H26BrNO3 and a molecular weight of 456.38 g/mol. Its IUPAC name is (4Z)-2-(2-bromophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-bromophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19669182 |
| Molecular Formula | C24H26BrNO3 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (4Z)-2-(2-bromophenyl)-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CC(C)(C)c1cc(/C=C2\N=C(c3ccccc3Br)OC2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H26BrNO3/c1-23(2,3)16-11-14(12-17(20(16)27)24(4,5)6)13-19-22(28)29-21(26-19)15-9-7-8-10-18(15)25/h7-13,27H,1-6H3/b19-13- |
| InChIKey | NNWXIAZJGIJUMI-UYRXBGFRSA-N |
| XLogP | 6.09 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|