C17H9BrF3NO2 — CID 6183828
(4E)-2-(2-bromophenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 6183828) has the molecular formula C17H9BrF3NO2 and a molecular weight of 396.16 g/mol. Its IUPAC name is (4E)-2-(2-bromophenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(2-bromophenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6183828 |
| Molecular Formula | C17H9BrF3NO2 |
| Molecular Weight | 396.16 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | (4E)-2-(2-bromophenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2Br)=N/C1=C/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H9BrF3NO2/c18-13-8-4-2-6-11(13)15-22-14(16(23)24-15)9-10-5-1-3-7-12(10)17(19,20)21/h1-9H/b14-9+ |
| InChIKey | AEGAAAQODQKKMK-NTEUORMPSA-N |
| XLogP | 4.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.16 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|