C18H12F3NO3 — CID 6079376
(4Z)-2-(3-methoxyphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 6079376) has the molecular formula C18H12F3NO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is (4Z)-2-(3-methoxyphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-methoxyphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6079376 |
| Molecular Formula | C18H12F3NO3 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (4Z)-2-(3-methoxyphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cccc(C2=N/C(=C\c3ccccc3C(F)(F)F)C(=O)O2)c1 |
| InChI | InChI=1S/C18H12F3NO3/c1-24-13-7-4-6-12(9-13)16-22-15(17(23)25-16)10-11-5-2-3-8-14(11)18(19,20)21/h2-10H,1H3/b15-10- |
| InChIKey | IISIBFKGPBWXOT-GDNBJRDFSA-N |
| XLogP | 4.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|