C17H12INO3 — CID 55346702
(4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-5-one (PubChem CID 55346702) has the molecular formula C17H12INO3 and a molecular weight of 405.19 g/mol. Its IUPAC name is (4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 55346702 |
| Molecular Formula | C17H12INO3 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | (4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1cccc(C2=N/C(=C\c3ccccc3I)C(=O)O2)c1 |
| InChI | InChI=1S/C17H12INO3/c1-21-13-7-4-6-12(9-13)16-19-15(17(20)22-16)10-11-5-2-3-8-14(11)18/h2-10H,1H3/b15-10- |
| InChIKey | WNUAQUHRFWXPAI-GDNBJRDFSA-N |
| XLogP | 3.64 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|