C24H19NO4 — CID 2180782
(4E)-2-(3-methoxyphenyl)-4-[(2-phenylmethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 2180782) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (4E)-2-(3-methoxyphenyl)-4-[(2-phenylmethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(3-methoxyphenyl)-4-[(2-phenylmethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2180782 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (4E)-2-(3-methoxyphenyl)-4-[(2-phenylmethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cccc(C2=N/C(=C/c3ccccc3OCc3ccccc3)C(=O)O2)c1 |
| InChI | InChI=1S/C24H19NO4/c1-27-20-12-7-11-19(14-20)23-25-21(24(26)29-23)15-18-10-5-6-13-22(18)28-16-17-8-3-2-4-9-17/h2-15H,16H2,1H3/b21-15+ |
| InChIKey | QHFIAPGQHJWVGG-RCCKNPSSSA-N |
| XLogP | 4.62 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|