C19H14NO6- — CID 9313319
2-[2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 9313319) has the molecular formula C19H14NO6- and a molecular weight of 352.32 g/mol. Its IUPAC name is 2-[2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9313319 |
| Molecular Formula | C19H14NO6- |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COc1cccc(C2=N/C(=C\c3ccccc3OCC(=O)[O-])C(=O)O2)c1 |
| InChI | InChI=1S/C19H15NO6/c1-24-14-7-4-6-13(9-14)18-20-15(19(23)26-18)10-12-5-2-3-8-16(12)25-11-17(21)22/h2-10H,11H2,1H3,(H,21,22)/p-1/b15-10- |
| InChIKey | KBNAMVNUDGDQFC-GDNBJRDFSA-M |
| XLogP | 1.17 |
| TPSA | 97.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|