C19H14NO5- — CID 9312908
2-[2-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 9312908) has the molecular formula C19H14NO5- and a molecular weight of 336.32 g/mol. Its IUPAC name is 2-[2-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9312908 |
| Molecular Formula | C19H14NO5- |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[2-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | Cc1cccc(C2=N/C(=C\c3ccccc3OCC(=O)[O-])C(=O)O2)c1 |
| InChI | InChI=1S/C19H15NO5/c1-12-5-4-7-14(9-12)18-20-15(19(23)25-18)10-13-6-2-3-8-16(13)24-11-17(21)22/h2-10H,11H2,1H3,(H,21,22)/p-1/b15-10- |
| InChIKey | QLVIUQVUGHOHKV-GDNBJRDFSA-M |
| XLogP | 1.47 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|