About Oxfenicine
Oxfenicine (PubChem CID 36143) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is (2S)-2-amino-2-(4-hydroxyphenyl)acetic acid.
Molecular Properties
| Compound Name | Oxfenicine |
| PubChem CID | 36143 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (2S)-2-amino-2-(4-hydroxyphenyl)acetic acid |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)N)O |
| InChI | InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m0/s1 |
| InChIKey | LJCWONGJFPCTTL-ZETCQYMHSA-N |
| XLogP | -2.10 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 164 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Oxfenicine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Oxfenicine?
The IUPAC name of Oxfenicine (CID 36143) is (2S)-2-amino-2-(4-hydroxyphenyl)acetic acid.
What is the SMILES notation for Oxfenicine?
The canonical SMILES for Oxfenicine is C1=CC(=CC=C1[C@@H](C(=O)O)N)O.
What is the InChIKey of Oxfenicine?
The InChIKey is LJCWONGJFPCTTL-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m0/s1.
What are the key properties of Oxfenicine?
Oxfenicine has a molecular weight of 167.16 g/mol, XLogP of -2.10, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Oxfenicine is sourced from PubChem (CID 36143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).