About 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid
2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (PubChem CID 6181) has the molecular formula C9H9I2NO3
and a molecular weight of 432.98 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| PubChem CID | 6181 |
| Molecular Formula | C9H9I2NO3 |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.87 |
| IUPAC Name | 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| SMILES | NC(Cc1cc(I)c(O)c(I)c1)C(=O)O |
| InChI | InChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15) |
| InChIKey | NYPYHUZRZVSYKL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
The IUPAC name of 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CID 6181) is 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid.
What is the SMILES notation for 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
The canonical SMILES for 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid is NC(Cc1cc(I)c(O)c(I)c1)C(=O)O.
What is the InChIKey of 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
The InChIKey is NYPYHUZRZVSYKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15).
What are the key properties of 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid has a molecular weight of 432.98 g/mol, XLogP of 1.56, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid is sourced from PubChem (CID 6181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).