C19H22N2O4 — CID 3616713
2,2,3,3-tetramethoxy-4-[2-(4-methylphenyl)ethenyl]cyclobutane-1,1-dicarbonitrile (PubChem CID 3616713) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2,2,3,3-tetramethoxy-4-[2-(4-methylphenyl)ethenyl]cyclobutane-1,1-dicarbonitrile.
| Compound Name | 2,2,3,3-tetramethoxy-4-[2-(4-methylphenyl)ethenyl]cyclobutane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 3616713 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2,2,3,3-tetramethoxy-4-[2-(4-methylphenyl)ethenyl]cyclobutane-1,1-dicarbonitrile |
| SMILES | COC1(OC)C(C=Cc2ccc(C)cc2)C(C#N)(C#N)C1(OC)OC |
| InChI | InChI=1S/C19H22N2O4/c1-14-6-8-15(9-7-14)10-11-16-17(12-20,13-21)19(24-4,25-5)18(16,22-2)23-3/h6-11,16H,1-5H3 |
| InChIKey | GYTCFYIQKPCWCT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|