C23H25NO6S — CID 40733941
trans-(1R,4S)-1-(benzenesulfonyl)-2,2,3,3-tetramethoxy-4-[(Z)-2-phenylethenyl]cyclobutane-1-carbonitrile (PubChem CID 40733941) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is trans-(1R,4S)-1-(benzenesulfonyl)-2,2,3,3-tetramethoxy-4-[(Z)-2-phenylethenyl]cyclobutane-1-carbonitrile.
| Compound Name | trans-(1R,4S)-1-(benzenesulfonyl)-2,2,3,3-tetramethoxy-4-[(Z)-2-phenylethenyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 40733941 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | trans-(1R,4S)-1-(benzenesulfonyl)-2,2,3,3-tetramethoxy-4-[(Z)-2-phenylethenyl]cyclobutane-1-carbonitrile |
| SMILES | COC1(OC)[C@H](/C=C\c2ccccc2)[C@](C#N)(S(=O)(=O)c2ccccc2)C1(OC)OC |
| InChI | InChI=1S/C23H25NO6S/c1-27-22(28-2)20(16-15-18-11-7-5-8-12-18)21(17-24,23(22,29-3)30-4)31(25,26)19-13-9-6-10-14-19/h5-16,20H,1-4H3/b16-15+/t20-,21+/m1/s1 |
| InChIKey | UHQVHKNFNDMQKB-NHQVPKDKSA-N |
| XLogP | 3.04 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|