C40H50ClFN2O4S — CID 3626767
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 3626767) has the molecular formula C40H50ClFN2O4S and a molecular weight of 709.37 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 3626767 |
| Molecular Formula | C40H50ClFN2O4S |
| Molecular Weight | 709.37 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-yl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | CC(C)NC(=O)N(CCc1cccs1)CC1(O)CCC2C34C=CC5(C=C3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C40H50ClFN2O4S/c1-25(2)43-35(47)44(19-13-27-7-6-20-49-27)24-39(48)16-12-34-37(39,4)15-11-33-36(3)14-10-26(45)22-38(36)17-18-40(33,34)29(23-38)32(46)21-28-30(41)8-5-9-31(28)42/h5-9,17-18,20,23,25-26,33-34,45,48H,10-16,19,21-22,24H2,1-4H3,(H,43,47) |
| InChIKey | DMMDSGCLYVJMAR-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.37 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|