C37H45ClFNO5S2 — CID 4107077
N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide (PubChem CID 4107077) has the molecular formula C37H45ClFNO5S2 and a molecular weight of 702.35 g/mol. Its IUPAC name is N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide.
| Compound Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 4107077 |
| Molecular Formula | C37H45ClFNO5S2 |
| Molecular Weight | 702.35 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)methanesulfonamide |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN(CCc1cccs1)S(C)(=O)=O |
| InChI | InChI=1S/C37H45ClFNO5S2/c1-33-13-9-24(41)21-35(33)16-17-37(27(22-35)30(42)20-26-28(38)7-4-8-29(26)39)31(33)10-14-34(2)32(37)11-15-36(34,43)23-40(47(3,44)45)18-12-25-6-5-19-46-25/h4-8,16-17,19,22,24,31-32,41,43H,9-15,18,20-21,23H2,1-3H3 |
| InChIKey | SBUQDZHIEZXADK-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.35 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|