C43H53F3N2O5 — CID 3629267
1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-(1-phenylethyl)urea (PubChem CID 3629267) has the molecular formula C43H53F3N2O5 and a molecular weight of 734.90 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-(1-phenylethyl)urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 3629267 |
| Molecular Formula | C43H53F3N2O5 |
| Molecular Weight | 734.90 g/mol |
| Exact Mass | 734.39 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-(1-phenylethyl)urea |
| SMILES | COCCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC5(C)C4CCC21C)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C43H53F3N2O5/c1-28(29-10-6-5-7-11-29)47-37(51)48(22-9-23-53-4)27-41(52)19-16-35-39(41,3)18-15-34-38(2)17-14-32(49)25-40(38)20-21-42(34,35)33(26-40)36(50)30-12-8-13-31(24-30)43(44,45)46/h5-8,10-13,20-21,24,26,28,32,34-35,49,52H,9,14-19,22-23,25,27H2,1-4H3,(H,47,51) |
| InChIKey | URZCTWMUTYFKFJ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.90 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|