C10H9NO2 — CID 3632176
(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylamino) acetate (PubChem CID 3632176) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is (7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylamino) acetate.
| Compound Name | (7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylamino) acetate |
|---|---|
| PubChem CID | 3632176 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylamino) acetate |
| SMILES | CC(=O)ONC1=Cc2ccccc21 |
| InChI | InChI=1S/C10H9NO2/c1-7(12)13-11-10-6-8-4-2-3-5-9(8)10/h2-6,11H,1H3 |
| InChIKey | LXXZWVNFJLKSHA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|