C10H20N2O — CID 3640751
3-cyclopentyl-1,1-diethylurea (PubChem CID 3640751) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-cyclopentyl-1,1-diethylurea.
| Compound Name | 3-cyclopentyl-1,1-diethylurea |
|---|---|
| PubChem CID | 3640751 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-cyclopentyl-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H20N2O/c1-3-12(4-2)10(13)11-9-7-5-6-8-9/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | HMXLKYUPEMJOGC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |