C21H18FNO4 — CID 3641289
N-(4-fluorophenyl)-2-[(7-methyl-2-oxochromen-4-yl)methyl]-3-oxobutanamide (PubChem CID 3641289) has the molecular formula C21H18FNO4 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(7-methyl-2-oxochromen-4-yl)methyl]-3-oxobutanamide.
| Compound Name | N-(4-fluorophenyl)-2-[(7-methyl-2-oxochromen-4-yl)methyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 3641289 |
| Molecular Formula | C21H18FNO4 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(7-methyl-2-oxochromen-4-yl)methyl]-3-oxobutanamide |
| SMILES | CC(=O)C(Cc1cc(=O)oc2cc(C)ccc12)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H18FNO4/c1-12-3-8-17-14(11-20(25)27-19(17)9-12)10-18(13(2)24)21(26)23-16-6-4-15(22)5-7-16/h3-9,11,18H,10H2,1-2H3,(H,23,26) |
| InChIKey | KDQBXNHFEQXEMR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|