C15H17N3O5 — CID 3644908
3,6-dimethyl-1-[3-(3-nitrophenoxy)propyl]pyrimidine-2,4-dione (PubChem CID 3644908) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3,6-dimethyl-1-[3-(3-nitrophenoxy)propyl]pyrimidine-2,4-dione.
| Compound Name | 3,6-dimethyl-1-[3-(3-nitrophenoxy)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3644908 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3,6-dimethyl-1-[3-(3-nitrophenoxy)propyl]pyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCOc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O5/c1-11-9-14(19)16(2)15(20)17(11)7-4-8-23-13-6-3-5-12(10-13)18(21)22/h3,5-6,9-10H,4,7-8H2,1-2H3 |
| InChIKey | UBBOMFGWNAGEOW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|