C24H30N4+2 — CID 3649005
2-(4-methylphenyl)-3-(3-piperidin-1-ium-1-ylpropyl)-4H-imidazo[1,2-a]benzimidazol-9-ium (PubChem CID 3649005) has the molecular formula C24H30N4+2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3-(3-piperidin-1-ium-1-ylpropyl)-4H-imidazo[1,2-a]benzimidazol-9-ium.
| Compound Name | 2-(4-methylphenyl)-3-(3-piperidin-1-ium-1-ylpropyl)-4H-imidazo[1,2-a]benzimidazol-9-ium |
|---|---|
| PubChem CID | 3649005 |
| Molecular Formula | C24H30N4+2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-(4-methylphenyl)-3-(3-piperidin-1-ium-1-ylpropyl)-4H-imidazo[1,2-a]benzimidazol-9-ium |
| SMILES | Cc1ccc(-c2c[n+]3c4ccccc4[nH]c3n2CCC[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C24H28N4/c1-19-10-12-20(13-11-19)23-18-28-22-9-4-3-8-21(22)25-24(28)27(23)17-7-16-26-14-5-2-6-15-26/h3-4,8-13,18H,2,5-7,14-17H2,1H3/p+2 |
| InChIKey | NAHVROQHDZCVSB-UHFFFAOYSA-P |
| XLogP | 3.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|