C14H21N3+2 — CID 5033514
3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium (PubChem CID 5033514) has the molecular formula C14H21N3+2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium.
| Compound Name | 3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium |
|---|---|
| PubChem CID | 5033514 |
| Molecular Formula | C14H21N3+2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium |
| SMILES | c1ccc2c(c1)[nH]c[n+]2CC[NH+]1CCCCC1 |
| InChI | InChI=1S/C14H19N3/c1-4-8-16(9-5-1)10-11-17-12-15-13-6-2-3-7-14(13)17/h2-3,6-7,12H,1,4-5,8-11H2/p+2 |
| InChIKey | LELPUNBOQMOIIH-UHFFFAOYSA-P |
| XLogP | 0.52 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|