C21H27Cl2N3 — CID 44654766
2-benzyl-3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium dichloride (PubChem CID 44654766) has the molecular formula C21H27Cl2N3 and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-benzyl-3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium dichloride.
| Compound Name | 2-benzyl-3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium dichloride |
|---|---|
| PubChem CID | 44654766 |
| Molecular Formula | C21H27Cl2N3 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-benzyl-3-(2-piperidin-1-ium-1-ylethyl)-1H-benzimidazol-3-ium dichloride |
| SMILES | [Cl-].[Cl-].c1ccc(Cc2[nH]c3ccccc3[n+]2CC[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25N3.2ClH/c1-3-9-18(10-4-1)17-21-22-19-11-5-6-12-20(19)24(21)16-15-23-13-7-2-8-14-23;;/h1,3-6,9-12H,2,7-8,13-17H2;2*1H |
| InChIKey | BEKKOKDEXAJRKY-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|