C11H7F8N3O — CID 3649851
1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentan-1-ol (PubChem CID 3649851) has the molecular formula C11H7F8N3O and a molecular weight of 349.18 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentan-1-ol.
| Compound Name | 1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentan-1-ol |
|---|---|
| PubChem CID | 3649851 |
| Molecular Formula | C11H7F8N3O |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 1-(benzotriazol-1-yl)-2,2,3,3,4,4,5,5-octafluoropentan-1-ol |
| SMILES | OC(n1nnc2ccccc21)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H7F8N3O/c12-7(13)9(14,15)11(18,19)10(16,17)8(23)22-6-4-2-1-3-5(6)20-21-22/h1-4,7-8,23H |
| InChIKey | GXHABCNYSUXVMT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|