C16H14FNO4 — CID 3652370
2-O-(4-fluorophenyl) 6-O-propan-2-yl pyridine-2,6-dicarboxylate (PubChem CID 3652370) has the molecular formula C16H14FNO4 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-O-(4-fluorophenyl) 6-O-propan-2-yl pyridine-2,6-dicarboxylate.
| Compound Name | 2-O-(4-fluorophenyl) 6-O-propan-2-yl pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 3652370 |
| Molecular Formula | C16H14FNO4 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-O-(4-fluorophenyl) 6-O-propan-2-yl pyridine-2,6-dicarboxylate |
| SMILES | CC(C)OC(=O)c1cccc(C(=O)Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H14FNO4/c1-10(2)21-15(19)13-4-3-5-14(18-13)16(20)22-12-8-6-11(17)7-9-12/h3-10H,1-2H3 |
| InChIKey | WGQRCAGJRKWSNT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|