C13H11N3O4 — CID 7979796
bis[(1S)-1-cyanoethyl] pyridine-2,6-dicarboxylate (PubChem CID 7979796) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is bis[(1S)-1-cyanoethyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[(1S)-1-cyanoethyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 7979796 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | bis[(1S)-1-cyanoethyl] pyridine-2,6-dicarboxylate |
| SMILES | C[C@@H](C#N)OC(=O)c1cccc(C(=O)O[C@@H](C)C#N)n1 |
| InChI | InChI=1S/C13H11N3O4/c1-8(6-14)19-12(17)10-4-3-5-11(16-10)13(18)20-9(2)7-15/h3-5,8-9H,1-2H3/t8-,9-/m0/s1 |
| InChIKey | JAVQNSTTYFGYRD-IUCAKERBSA-N |
| XLogP | 1.22 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |