C16H14N2O7 — CID 3653453
2-amino-4-(4-hydroxy-3-methoxyphenyl)-7-methyl-3-nitro-4H-pyrano[3,2-c]pyran-5-one (PubChem CID 3653453) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-amino-4-(4-hydroxy-3-methoxyphenyl)-7-methyl-3-nitro-4H-pyrano[3,2-c]pyran-5-one.
| Compound Name | 2-amino-4-(4-hydroxy-3-methoxyphenyl)-7-methyl-3-nitro-4H-pyrano[3,2-c]pyran-5-one |
|---|---|
| PubChem CID | 3653453 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-amino-4-(4-hydroxy-3-methoxyphenyl)-7-methyl-3-nitro-4H-pyrano[3,2-c]pyran-5-one |
| SMILES | COc1cc(C2C([N+](=O)[O-])=C(N)Oc3cc(C)oc(=O)c32)ccc1O |
| InChI | InChI=1S/C16H14N2O7/c1-7-5-11-13(16(20)24-7)12(14(18(21)22)15(17)25-11)8-3-4-9(19)10(6-8)23-2/h3-6,12,19H,17H2,1-2H3 |
| InChIKey | PJYWUIURDNWXEQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|