C10H21N4+ — CID 3653775
1-butyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane (PubChem CID 3653775) has the molecular formula C10H21N4+ and a molecular weight of 197.31 g/mol. Its IUPAC name is 1-butyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane.
| Compound Name | 1-butyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 3653775 |
| Molecular Formula | C10H21N4+ |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-butyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane |
| SMILES | CCCC[N+]12CN3CN(CN(C3)C1)C2 |
| InChI | InChI=1S/C10H21N4/c1-2-3-4-14-8-11-5-12(9-14)7-13(6-11)10-14/h2-10H2,1H3/q+1 |
| InChIKey | PWYBQPFBSCKBJN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|