C15H14N2O3S3 — CID 3654894
3-[(4-propan-2-ylsulfonylthiophen-3-yl)amino]-2-(thiophene-2-carbonyl)prop-2-enenitrile (PubChem CID 3654894) has the molecular formula C15H14N2O3S3 and a molecular weight of 366.49 g/mol. Its IUPAC name is 3-[(4-propan-2-ylsulfonylthiophen-3-yl)amino]-2-(thiophene-2-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[(4-propan-2-ylsulfonylthiophen-3-yl)amino]-2-(thiophene-2-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3654894 |
| Molecular Formula | C15H14N2O3S3 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 3-[(4-propan-2-ylsulfonylthiophen-3-yl)amino]-2-(thiophene-2-carbonyl)prop-2-enenitrile |
| SMILES | CC(C)S(=O)(=O)c1cscc1NC=C(C#N)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H14N2O3S3/c1-10(2)23(19,20)14-9-21-8-12(14)17-7-11(6-16)15(18)13-4-3-5-22-13/h3-5,7-10,17H,1-2H3 |
| InChIKey | OACMVDDQTPJULG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|