C12H8N4OS — CID 2819157
(E)-3-(pyrimidin-2-ylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile (PubChem CID 2819157) has the molecular formula C12H8N4OS and a molecular weight of 256.29 g/mol. Its IUPAC name is (E)-3-(pyrimidin-2-ylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(pyrimidin-2-ylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2819157 |
| Molecular Formula | C12H8N4OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | (E)-3-(pyrimidin-2-ylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ncccn1)C(=O)c1cccs1 |
| InChI | InChI=1S/C12H8N4OS/c13-7-9(11(17)10-3-1-6-18-10)8-16-12-14-4-2-5-15-12/h1-6,8H,(H,14,15,16)/b9-8+ |
| InChIKey | BDVCNPJIHMYEHW-CMDGGOBGSA-N |
| XLogP | 2.24 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|