C21H15F3N2O3 — CID 36660463
5-[(2-oxo-1-pyridinyl)methyl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-2-carboxamide (PubChem CID 36660463) has the molecular formula C21H15F3N2O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is 5-[(2-oxo-1-pyridinyl)methyl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-2-carboxamide.
| Compound Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 36660463 |
| Molecular Formula | C21H15F3N2O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-2-carboxamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C21H15F3N2O3/c22-21(23,24)16-7-3-5-15(13-16)6-4-11-25-20(28)18-10-9-17(29-18)14-26-12-2-1-8-19(26)27/h1-3,5,7-10,12-13H,11,14H2,(H,25,28) |
| InChIKey | POBAMCXWUGZWOY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|