C21H22N2O3S — CID 3666645
N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 3666645) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3666645 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(C=CC(=O)NC2=NCCS2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-2-25-19-14-16(9-11-20(24)23-21-22-12-13-27-21)8-10-18(19)26-15-17-6-4-3-5-7-17/h3-11,14H,2,12-13,15H2,1H3,(H,22,23,24) |
| InChIKey | LIKIJJAEZRXCEF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|