C21H25N3O4 — CID 3668058
(4-methoxyphenyl)methyl N-[[4-oxo-4-(1-phenylethylamino)but-1-en-2-yl]amino]carbamate (PubChem CID 3668058) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[[4-oxo-4-(1-phenylethylamino)but-1-en-2-yl]amino]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[[4-oxo-4-(1-phenylethylamino)but-1-en-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 3668058 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[[4-oxo-4-(1-phenylethylamino)but-1-en-2-yl]amino]carbamate |
| SMILES | C=C(CC(=O)NC(C)c1ccccc1)NNC(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-15(13-20(25)22-16(2)18-7-5-4-6-8-18)23-24-21(26)28-14-17-9-11-19(27-3)12-10-17/h4-12,16,23H,1,13-14H2,2-3H3,(H,22,25)(H,24,26) |
| InChIKey | WBPADXGNYOSUPW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|