C20H23N3O5 — CID 5178255
(4-methoxyphenyl)methyl N-[[4-(3-methoxyanilino)-4-oxobut-1-en-2-yl]amino]carbamate (PubChem CID 5178255) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[[4-(3-methoxyanilino)-4-oxobut-1-en-2-yl]amino]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[[4-(3-methoxyanilino)-4-oxobut-1-en-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 5178255 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[[4-(3-methoxyanilino)-4-oxobut-1-en-2-yl]amino]carbamate |
| SMILES | C=C(CC(=O)Nc1cccc(OC)c1)NNC(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-14(11-19(24)21-16-5-4-6-18(12-16)27-3)22-23-20(25)28-13-15-7-9-17(26-2)10-8-15/h4-10,12,22H,1,11,13H2,2-3H3,(H,21,24)(H,23,25) |
| InChIKey | CEQCLIGLGIMLQT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|