C20H17ClN4O3 — CID 3669701
(2-chloro-3-pyridinyl)-[2-(4-methoxyquinoline-2-carbonyl)pyrazolidin-1-yl]methanone (PubChem CID 3669701) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-[2-(4-methoxyquinoline-2-carbonyl)pyrazolidin-1-yl]methanone.
| Compound Name | (2-chloro-3-pyridinyl)-[2-(4-methoxyquinoline-2-carbonyl)pyrazolidin-1-yl]methanone |
|---|---|
| PubChem CID | 3669701 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (2-chloro-3-pyridinyl)-[2-(4-methoxyquinoline-2-carbonyl)pyrazolidin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCCN2C(=O)c2cccnc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C20H17ClN4O3/c1-28-17-12-16(23-15-8-3-2-6-13(15)17)20(27)25-11-5-10-24(25)19(26)14-7-4-9-22-18(14)21/h2-4,6-9,12H,5,10-11H2,1H3 |
| InChIKey | DGVFSFUPHZMBIG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|