C18H17N5O3S — CID 3835128
(4-methoxyquinolin-2-yl)-[2-(4-methylthiadiazole-5-carbonyl)pyrazolidin-1-yl]methanone (PubChem CID 3835128) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is (4-methoxyquinolin-2-yl)-[2-(4-methylthiadiazole-5-carbonyl)pyrazolidin-1-yl]methanone.
| Compound Name | (4-methoxyquinolin-2-yl)-[2-(4-methylthiadiazole-5-carbonyl)pyrazolidin-1-yl]methanone |
|---|---|
| PubChem CID | 3835128 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (4-methoxyquinolin-2-yl)-[2-(4-methylthiadiazole-5-carbonyl)pyrazolidin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCCN2C(=O)c2snnc2C)nc2ccccc12 |
| InChI | InChI=1S/C18H17N5O3S/c1-11-16(27-21-20-11)18(25)23-9-5-8-22(23)17(24)14-10-15(26-2)12-6-3-4-7-13(12)19-14/h3-4,6-7,10H,5,8-9H2,1-2H3 |
| InChIKey | QQJQCKAZCUNYMW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |