C24H25N3O2S2 — CID 3669937
2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3669937) has the molecular formula C24H25N3O2S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3669937 |
| Molecular Formula | C24H25N3O2S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CN1C(=CC(=O)CSc2nc3sc4c(c3c(=O)[nH]2)CCCC4)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H25N3O2S2/c1-24(2)16-9-5-6-10-17(16)27(3)19(24)12-14(28)13-30-23-25-21(29)20-15-8-4-7-11-18(15)31-22(20)26-23/h5-6,9-10,12H,4,7-8,11,13H2,1-3H3,(H,25,26,29) |
| InChIKey | XFMQGDJCEYEJJU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|