C26H29N3O2S2 — CID 4016231
3-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4016231) has the molecular formula C26H29N3O2S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 3-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4016231 |
| Molecular Formula | C26H29N3O2S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 3-ethyl-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c(SCC(=O)C=C2N(C)c3ccccc3C2(C)C)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C26H29N3O2S2/c1-5-29-24(31)22-17-10-6-9-13-20(17)33-23(22)27-25(29)32-15-16(30)14-21-26(2,3)18-11-7-8-12-19(18)28(21)4/h7-8,11-12,14H,5-6,9-10,13,15H2,1-4H3 |
| InChIKey | YSLUIMVRWWLSHL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|