C27H21FN2O5S — CID 3671774
1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 3671774) has the molecular formula C27H21FN2O5S and a molecular weight of 504.54 g/mol. Its IUPAC name is 1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3671774 |
| Molecular Formula | C27H21FN2O5S |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc2nc(N3C(=O)C(=O)C(=C(O)c4ccc(F)cc4)C3c3ccc(O)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C27H21FN2O5S/c1-3-14-4-10-18-21(12-14)36-27(29-18)30-23(16-7-11-19(31)20(13-16)35-2)22(25(33)26(30)34)24(32)15-5-8-17(28)9-6-15/h4-13,23,31-32H,3H2,1-2H3 |
| InChIKey | SDJDTTHXULMRCK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|