C16H26N2O4 — CID 3673721
N-[3-(tert-butylamino)-3-oxopropyl]-N-(2-methoxyethyl)-2-methylfuran-3-carboxamide (PubChem CID 3673721) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is N-[3-(tert-butylamino)-3-oxopropyl]-N-(2-methoxyethyl)-2-methylfuran-3-carboxamide.
| Compound Name | N-[3-(tert-butylamino)-3-oxopropyl]-N-(2-methoxyethyl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 3673721 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-[3-(tert-butylamino)-3-oxopropyl]-N-(2-methoxyethyl)-2-methylfuran-3-carboxamide |
| SMILES | COCCN(CCC(=O)NC(C)(C)C)C(=O)c1ccoc1C |
| InChI | InChI=1S/C16H26N2O4/c1-12-13(7-10-22-12)15(20)18(9-11-21-5)8-6-14(19)17-16(2,3)4/h7,10H,6,8-9,11H2,1-5H3,(H,17,19) |
| InChIKey | OZCXETDAFSXQEN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |