C13H19NO5 — CID 78959326
methyl 3-[2-methoxyethyl-(3-methylfuran-2-carbonyl)amino]propanoate (PubChem CID 78959326) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 3-[2-methoxyethyl-(3-methylfuran-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[2-methoxyethyl-(3-methylfuran-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 78959326 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl 3-[2-methoxyethyl-(3-methylfuran-2-carbonyl)amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)C(=O)c1occc1C |
| InChI | InChI=1S/C13H19NO5/c1-10-5-8-19-12(10)13(16)14(7-9-17-2)6-4-11(15)18-3/h5,8H,4,6-7,9H2,1-3H3 |
| InChIKey | JJSLDWAVWLSPSN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |