C20H23N3O3S — CID 36745480
1-[[(4S)-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-3-methylbenzimidazole-2-thione (PubChem CID 36745480) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[[(4S)-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-3-methylbenzimidazole-2-thione.
| Compound Name | 1-[[(4S)-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-3-methylbenzimidazole-2-thione |
|---|---|
| PubChem CID | 36745480 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[[(4S)-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]-3-methylbenzimidazole-2-thione |
| SMILES | COc1ccc(OC)c2c1CN(Cn1c(=S)n(C)c3ccccc31)C[C@H]2O |
| InChI | InChI=1S/C20H23N3O3S/c1-21-14-6-4-5-7-15(14)23(20(21)27)12-22-10-13-17(25-2)8-9-18(26-3)19(13)16(24)11-22/h4-9,16,24H,10-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | HMMONQAQTNUQON-MRXNPFEDSA-N |
| XLogP | 3.23 |
| TPSA | 51.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|