C21H18N4O6 — CID 3675333
3-[4-(3,5-dinitrophenoxy)phenyl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 3675333) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is 3-[4-(3,5-dinitrophenoxy)phenyl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[4-(3,5-dinitrophenoxy)phenyl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 3675333 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 3-[4-(3,5-dinitrophenoxy)phenyl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CCc1ccc(Oc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1)NCc1cccnc1 |
| InChI | InChI=1S/C21H18N4O6/c26-21(23-14-16-2-1-9-22-13-16)8-5-15-3-6-19(7-4-15)31-20-11-17(24(27)28)10-18(12-20)25(29)30/h1-4,6-7,9-13H,5,8,14H2,(H,23,26) |
| InChIKey | VHUOYPFJOAMHQB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|