About [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate
[4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate (PubChem CID 3678655) has the molecular formula C15H16N2O4S
and a molecular weight of 320.37 g/mol. Its IUPAC name is [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate.
Molecular Properties
| Compound Name | [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate |
| PubChem CID | 3678655 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate |
| SMILES | NNC(=O)c1ccc(OS(=O)(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N2O4S/c16-17-15(18)13-6-8-14(9-7-13)21-22(19,20)11-10-12-4-2-1-3-5-12/h1-9H,10-11,16H2,(H,17,18) |
| InChIKey | UGMRCMNBCKEBQC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate?
The IUPAC name of [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate (CID 3678655) is [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate.
What is the SMILES notation for [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate?
The canonical SMILES for [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate is NNC(=O)c1ccc(OS(=O)(=O)CCc2ccccc2)cc1.
What is the InChIKey of [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate?
The InChIKey is UGMRCMNBCKEBQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4S/c16-17-15(18)13-6-8-14(9-7-13)21-22(19,20)11-10-12-4-2-1-3-5-12/h1-9H,10-11,16H2,(H,17,18).
What are the key properties of [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate?
[4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate has a molecular weight of 320.37 g/mol, XLogP of 1.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydrazinecarbonyl)phenyl] 2-phenylethanesulfonate is sourced from PubChem (CID 3678655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).